C18H29N3 — CID 64940217
2,5,5-trimethyl-1-(4-piperidin-1-ylphenyl)piperazine (PubChem CID 64940217) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is 2,5,5-trimethyl-1-(4-piperidin-1-ylphenyl)piperazine.
| Compound Name | 2,5,5-trimethyl-1-(4-piperidin-1-ylphenyl)piperazine |
|---|---|
| PubChem CID | 64940217 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | 2,5,5-trimethyl-1-(4-piperidin-1-ylphenyl)piperazine |
| SMILES | CC1CNC(C)(C)CN1c1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H29N3/c1-15-13-19-18(2,3)14-21(15)17-9-7-16(8-10-17)20-11-5-4-6-12-20/h7-10,15,19H,4-6,11-14H2,1-3H3 |
| InChIKey | GVXSUJXJQCFNKA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|