C17H27N3O — CID 64941183
4-[4-(2,5,5-trimethylpiperazin-1-yl)phenyl]morpholine (PubChem CID 64941183) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-[4-(2,5,5-trimethylpiperazin-1-yl)phenyl]morpholine.
| Compound Name | 4-[4-(2,5,5-trimethylpiperazin-1-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 64941183 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 4-[4-(2,5,5-trimethylpiperazin-1-yl)phenyl]morpholine |
| SMILES | CC1CNC(C)(C)CN1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H27N3O/c1-14-12-18-17(2,3)13-20(14)16-6-4-15(5-7-16)19-8-10-21-11-9-19/h4-7,14,18H,8-13H2,1-3H3 |
| InChIKey | NHAGUFAMKTWHQI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|