C19H29N3O — CID 138543852
4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]morpholine (PubChem CID 138543852) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]morpholine.
| Compound Name | 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 138543852 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]morpholine |
| SMILES | CC1(C)C[C@@H]2CNC[C@H]1N(c1ccc(N3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C19H29N3O/c1-19(2)11-15-12-20-13-18(19)22(14-15)17-5-3-16(4-6-17)21-7-9-23-10-8-21/h3-6,15,18,20H,7-14H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | VVYJHKGOMDFEHQ-CRAIPNDOSA-N |
| XLogP | 2.35 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|