C24H36N4O5S2 — CID 138551718
(1,1-dioxo-1,4-thiazinan-4-yl)-[6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone (PubChem CID 138551718) has the molecular formula C24H36N4O5S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 138551718 |
| Molecular Formula | C24H36N4O5S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
| SMILES | CC1(C)CC2CN(C(=O)N3CCS(=O)(=O)CC3)CC1N(c1ccc(N3CCS(=O)(=O)CC3)cc1)C2 |
| InChI | InChI=1S/C24H36N4O5S2/c1-24(2)15-19-16-27(23(29)26-9-13-35(32,33)14-10-26)18-22(24)28(17-19)21-5-3-20(4-6-21)25-7-11-34(30,31)12-8-25/h3-6,19,22H,7-18H2,1-2H3 |
| InChIKey | QFDBGKXWVPDRBB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|