C23H36N4O5S2 — CID 162699545
2-(2-aminoethylsulfonyl)-1-[(1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone (PubChem CID 162699545) has the molecular formula C23H36N4O5S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 2-(2-aminoethylsulfonyl)-1-[(1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone.
| Compound Name | 2-(2-aminoethylsulfonyl)-1-[(1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone |
|---|---|
| PubChem CID | 162699545 |
| Molecular Formula | C23H36N4O5S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-(2-aminoethylsulfonyl)-1-[(1S,5S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]ethanone |
| SMILES | CC1(C)C[C@@H]2CN(C(=O)CS(=O)(=O)CCN)C[C@H]1N(c1ccc(N3CCS(=O)(=O)CC3)cc1)C2 |
| InChI | InChI=1S/C23H36N4O5S2/c1-23(2)13-18-14-26(22(28)17-34(31,32)10-7-24)16-21(23)27(15-18)20-5-3-19(4-6-20)25-8-11-33(29,30)12-9-25/h3-6,18,21H,7-17,24H2,1-2H3/t18-,21-/m1/s1 |
| InChIKey | NMFKDVBQZSGSQB-WIYYLYMNSA-N |
| XLogP | 0.36 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|