C22H34N4O5S2 — CID 166948996
1-[(3aR,6aS)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-aminoethylsulfonyl)ethanone (PubChem CID 166948996) has the molecular formula C22H34N4O5S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-aminoethylsulfonyl)ethanone.
| Compound Name | 1-[(3aR,6aS)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-aminoethylsulfonyl)ethanone |
|---|---|
| PubChem CID | 166948996 |
| Molecular Formula | C22H34N4O5S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[(3aR,6aS)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3a,6a-dimethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-aminoethylsulfonyl)ethanone |
| SMILES | C[C@@]12CN(C(=O)CS(=O)(=O)CCN)C[C@]1(C)CN(c1ccc(N3CCS(=O)(=O)CC3)cc1)C2 |
| InChI | InChI=1S/C22H34N4O5S2/c1-21-14-25(19-5-3-18(4-6-19)24-8-11-32(28,29)12-9-24)15-22(21,2)17-26(16-21)20(27)13-33(30,31)10-7-23/h3-6H,7-17,23H2,1-2H3/t21-,22+ |
| InChIKey | BZIPIAWCJBMOHR-SZPZYZBQSA-N |
| XLogP | -0.03 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|