C22H32N4O5S2 — CID 146613430
2-(2-aminoethylsulfonyl)-1-[(3S,6S)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-methyl-5,8-diazatricyclo[4.3.0.03,9]nonan-8-yl]ethanone (PubChem CID 146613430) has the molecular formula C22H32N4O5S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-(2-aminoethylsulfonyl)-1-[(3S,6S)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-methyl-5,8-diazatricyclo[4.3.0.03,9]nonan-8-yl]ethanone.
| Compound Name | 2-(2-aminoethylsulfonyl)-1-[(3S,6S)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-methyl-5,8-diazatricyclo[4.3.0.03,9]nonan-8-yl]ethanone |
|---|---|
| PubChem CID | 146613430 |
| Molecular Formula | C22H32N4O5S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-(2-aminoethylsulfonyl)-1-[(3S,6S)-5-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1-methyl-5,8-diazatricyclo[4.3.0.03,9]nonan-8-yl]ethanone |
| SMILES | CC12C[C@H]3CN(c4ccc(N5CCS(=O)(=O)CC5)cc4)[C@@H]1CN(C(=O)CS(=O)(=O)CCN)C32 |
| InChI | InChI=1S/C22H32N4O5S2/c1-22-12-16-13-25(18-4-2-17(3-5-18)24-7-10-32(28,29)11-8-24)19(22)14-26(21(16)22)20(27)15-33(30,31)9-6-23/h2-5,16,19,21H,6-15,23H2,1H3/t16-,19+,21?,22?/m0/s1 |
| InChIKey | DLYOHNIBHRSJIY-VYRUVADXSA-N |
| XLogP | -0.28 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|