C19H29N3O2S — CID 138543752
4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 138543752) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 138543752 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 4-[4-[(1R,5S)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonan-6-yl]phenyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1(C)C[C@@H]2CNC[C@H]1N(c1ccc(N3CCS(=O)(=O)CC3)cc1)C2 |
| InChI | InChI=1S/C19H29N3O2S/c1-19(2)11-15-12-20-13-18(19)22(14-15)17-5-3-16(4-6-17)21-7-9-25(23,24)10-8-21/h3-6,15,18,20H,7-14H2,1-2H3/t15-,18-/m1/s1 |
| InChIKey | JTWHOVVXYDDRDZ-CRAIPNDOSA-N |
| XLogP | 1.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|