C22H36N4OS — CID 142556135
9,9-dimethyl-6-(4-thiomorpholin-4-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbaldehyde;N-methylmethanamine (PubChem CID 142556135) has the molecular formula C22H36N4OS and a molecular weight of 404.62 g/mol. Its IUPAC name is 9,9-dimethyl-6-(4-thiomorpholin-4-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbaldehyde;N-methylmethanamine.
| Compound Name | 9,9-dimethyl-6-(4-thiomorpholin-4-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbaldehyde;N-methylmethanamine |
|---|---|
| PubChem CID | 142556135 |
| Molecular Formula | C22H36N4OS |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 9,9-dimethyl-6-(4-thiomorpholin-4-ylphenyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbaldehyde;N-methylmethanamine |
| SMILES | CC1(C)CC2CN(C=O)CC1N(c1ccc(N3CCSCC3)cc1)C2.CNC |
| InChI | InChI=1S/C20H29N3OS.C2H7N/c1-20(2)11-16-12-21(15-24)14-19(20)23(13-16)18-5-3-17(4-6-18)22-7-9-25-10-8-22;1-3-2/h3-6,15-16,19H,7-14H2,1-2H3;3H,1-2H3 |
| InChIKey | PKRQRWIATLHNKJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|