C21H32N4O3S — CID 155220706
(1S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 155220706) has the molecular formula C21H32N4O3S and a molecular weight of 420.58 g/mol. Its IUPAC name is (1S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
| Compound Name | (1S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
|---|---|
| PubChem CID | 155220706 |
| Molecular Formula | C21H32N4O3S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (1S)-6-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-N,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CNC(=O)N1CC2N(c3ccc(N4CCS(=O)(=O)CC4)cc3)C[C@@H](C1)CC2(C)C |
| InChI | InChI=1S/C21H32N4O3S/c1-21(2)12-16-13-24(20(26)22-3)15-19(21)25(14-16)18-6-4-17(5-7-18)23-8-10-29(27,28)11-9-23/h4-7,16,19H,8-15H2,1-3H3,(H,22,26)/t16-,19?/m1/s1 |
| InChIKey | RWDIQUMEFVXEIN-VTBWFHPJSA-N |
| XLogP | 1.80 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|