C24H34N4O2 — CID 148634843
1-[6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]piperidine-4-carbonitrile (PubChem CID 148634843) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]piperidine-4-carbonitrile.
| Compound Name | 1-[6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 148634843 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1-[6-(4-ethoxyphenyl)-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]piperidine-4-carbonitrile |
| SMILES | CCOc1ccc(N2CC3CN(C(=O)N4CCC(C#N)CC4)CC2C(C)(C)C3)cc1 |
| InChI | InChI=1S/C24H34N4O2/c1-4-30-21-7-5-20(6-8-21)28-16-19-13-24(2,3)22(28)17-27(15-19)23(29)26-11-9-18(14-25)10-12-26/h5-8,18-19,22H,4,9-13,15-17H2,1-3H3 |
| InChIKey | NIWDJRNWHCMWER-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|