C18H26N2O — CID 146613170
(6R,8R)-4-(4-ethoxyphenyl)-1,8-dimethyl-4,9-diazatricyclo[4.2.2.03,8]decane (PubChem CID 146613170) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is (6R,8R)-4-(4-ethoxyphenyl)-1,8-dimethyl-4,9-diazatricyclo[4.2.2.03,8]decane.
| Compound Name | (6R,8R)-4-(4-ethoxyphenyl)-1,8-dimethyl-4,9-diazatricyclo[4.2.2.03,8]decane |
|---|---|
| PubChem CID | 146613170 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (6R,8R)-4-(4-ethoxyphenyl)-1,8-dimethyl-4,9-diazatricyclo[4.2.2.03,8]decane |
| SMILES | CCOc1ccc(N2C[C@H]3CNC4(C)CC2[C@@]4(C)C3)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-4-21-15-7-5-14(6-8-15)20-12-13-9-17(2)16(20)10-18(17,3)19-11-13/h5-8,13,16,19H,4,9-12H2,1-3H3/t13-,16?,17-,18?/m1/s1 |
| InChIKey | CVIZBGQQLGOWLF-OEWOMKROSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|