C23H29FN2O3S — CID 155627928
(5S)-6-(4-ethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 155627928) has the molecular formula C23H29FN2O3S and a molecular weight of 432.56 g/mol. Its IUPAC name is (5S)-6-(4-ethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (5S)-6-(4-ethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 155627928 |
| Molecular Formula | C23H29FN2O3S |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (5S)-6-(4-ethoxyphenyl)-3-(4-fluorophenyl)sulfonyl-9,9-dimethyl-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | CCOc1ccc(N2CC3CN(S(=O)(=O)c4ccc(F)cc4)C[C@@H]2C(C)(C)C3)cc1 |
| InChI | InChI=1S/C23H29FN2O3S/c1-4-29-20-9-7-19(8-10-20)26-15-17-13-23(2,3)22(26)16-25(14-17)30(27,28)21-11-5-18(24)6-12-21/h5-12,17,22H,4,13-16H2,1-3H3/t17?,22-/m1/s1 |
| InChIKey | OQDJPKMMKAJNRR-IVAFLUGOSA-N |
| XLogP | 4.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|