C21H33N3O3 — CID 155220578
9-(4-ethoxyphenyl)-N-(2-hydroxyethyl)-8,8-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide (PubChem CID 155220578) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 9-(4-ethoxyphenyl)-N-(2-hydroxyethyl)-8,8-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide.
| Compound Name | 9-(4-ethoxyphenyl)-N-(2-hydroxyethyl)-8,8-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide |
|---|---|
| PubChem CID | 155220578 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 9-(4-ethoxyphenyl)-N-(2-hydroxyethyl)-8,8-dimethyl-3,9-diazabicyclo[3.3.2]decane-3-carboxamide |
| SMILES | CCOc1ccc(N2CC3CCC(C)(C)C2CN(C(=O)NCCO)C3)cc1 |
| InChI | InChI=1S/C21H33N3O3/c1-4-27-18-7-5-17(6-8-18)24-14-16-9-10-21(2,3)19(24)15-23(13-16)20(26)22-11-12-25/h5-8,16,19,25H,4,9-15H2,1-3H3,(H,22,26) |
| InChIKey | VYGLCMNZAJAQHQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|