C25H36N4O5S2 — CID 155220820
(1,1-dioxo-1,4-thiazinan-4-yl)-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,8-dimethyl-4,10-diazatricyclo[4.2.2.03,8]decan-10-yl]methanone (PubChem CID 155220820) has the molecular formula C25H36N4O5S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,8-dimethyl-4,10-diazatricyclo[4.2.2.03,8]decan-10-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,8-dimethyl-4,10-diazatricyclo[4.2.2.03,8]decan-10-yl]methanone |
|---|---|
| PubChem CID | 155220820 |
| Molecular Formula | C25H36N4O5S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[4-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-1,8-dimethyl-4,10-diazatricyclo[4.2.2.03,8]decan-10-yl]methanone |
| SMILES | CC12CC3N(c4ccc(N5CCS(=O)(=O)CC5)cc4)CC(CC31C)N(C(=O)N1CCS(=O)(=O)CC1)C2 |
| InChI | InChI=1S/C25H36N4O5S2/c1-24-16-22-25(24,2)15-21(29(18-24)23(30)27-9-13-36(33,34)14-10-27)17-28(22)20-5-3-19(4-6-20)26-7-11-35(31,32)12-8-26/h3-6,21-22H,7-18H2,1-2H3 |
| InChIKey | ONBNXPIMSBHOLT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|