C26H37N3O3S — CID 166949298
2-[4-[(1R)-6-(4-ethoxyphenyl)-1,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]phenyl]sulfonylethanamine (PubChem CID 166949298) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is 2-[4-[(1R)-6-(4-ethoxyphenyl)-1,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]phenyl]sulfonylethanamine.
| Compound Name | 2-[4-[(1R)-6-(4-ethoxyphenyl)-1,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]phenyl]sulfonylethanamine |
|---|---|
| PubChem CID | 166949298 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 2-[4-[(1R)-6-(4-ethoxyphenyl)-1,9,9-trimethyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]phenyl]sulfonylethanamine |
| SMILES | CCOc1ccc(N2C[C@@]3(C)CN(c4ccc(S(=O)(=O)CCN)cc4)CC2C(C)(C)C3)cc1 |
| InChI | InChI=1S/C26H37N3O3S/c1-5-32-22-10-6-21(7-11-22)29-19-26(4)17-25(2,3)24(29)16-28(18-26)20-8-12-23(13-9-20)33(30,31)15-14-27/h6-13,24H,5,14-19,27H2,1-4H3/t24?,26-/m1/s1 |
| InChIKey | NVZCODOLAOCWSE-JUERFOTFSA-N |
| XLogP | 3.95 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|