C14H16N6O2 — CID 155214722
2-amino-9-(6-tert-butyl-2-pyridinyl)-1,7-dihydropurine-6,8-dione (PubChem CID 155214722) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-amino-9-(6-tert-butyl-2-pyridinyl)-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-(6-tert-butyl-2-pyridinyl)-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 155214722 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-amino-9-(6-tert-butyl-2-pyridinyl)-1,7-dihydropurine-6,8-dione |
| SMILES | CC(C)(C)c1cccc(-n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)n1 |
| InChI | InChI=1S/C14H16N6O2/c1-14(2,3)7-5-4-6-8(16-7)20-10-9(17-13(20)22)11(21)19-12(15)18-10/h4-6H,1-3H3,(H,17,22)(H3,15,18,19,21) |
| InChIKey | CWMWQTWBYFMFNP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |