C5H6N6O2 — CID 66980062
3,8-diamino-7H-purine-2,6-dione (PubChem CID 66980062) has the molecular formula C5H6N6O2 and a molecular weight of 182.14 g/mol. Its IUPAC name is 3,8-diamino-7H-purine-2,6-dione.
| Compound Name | 3,8-diamino-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 66980062 |
| Molecular Formula | C5H6N6O2 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3,8-diamino-7H-purine-2,6-dione |
| SMILES | Nc1nc2c([nH]1)c(=O)[nH]c(=O)n2N |
| InChI | InChI=1S/C5H6N6O2/c6-4-8-1-2(9-4)11(7)5(13)10-3(1)12/h7H2,(H3,6,8,9)(H,10,12,13) |
| InChIKey | JOEYDLASECMWMY-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |