C10H8N10O2 — CID 136623389
2-amino-9-(2-aminopurin-9-yl)-1,7-dihydropurine-6,8-dione (PubChem CID 136623389) has the molecular formula C10H8N10O2 and a molecular weight of 300.24 g/mol. Its IUPAC name is 2-amino-9-(2-aminopurin-9-yl)-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-(2-aminopurin-9-yl)-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 136623389 |
| Molecular Formula | C10H8N10O2 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-amino-9-(2-aminopurin-9-yl)-1,7-dihydropurine-6,8-dione |
| SMILES | Nc1ncc2ncn(-n3c(=O)[nH]c4c(=O)[nH]c(N)nc43)c2n1 |
| InChI | InChI=1S/C10H8N10O2/c11-8-13-1-3-5(16-8)19(2-14-3)20-6-4(15-10(20)22)7(21)18-9(12)17-6/h1-2H,(H,15,22)(H2,11,13,16)(H3,12,17,18,21) |
| InChIKey | OGDHRABQLDPRIZ-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |