C8H11IN4O — CID 155217850
1,3-diamino-1-(2-iodo-3-methylphenyl)urea (PubChem CID 155217850) has the molecular formula C8H11IN4O and a molecular weight of 306.11 g/mol. Its IUPAC name is 1,3-diamino-1-(2-iodo-3-methylphenyl)urea.
| Compound Name | 1,3-diamino-1-(2-iodo-3-methylphenyl)urea |
|---|---|
| PubChem CID | 155217850 |
| Molecular Formula | C8H11IN4O |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1,3-diamino-1-(2-iodo-3-methylphenyl)urea |
| SMILES | Cc1cccc(N(N)C(=O)NN)c1I |
| InChI | InChI=1S/C8H11IN4O/c1-5-3-2-4-6(7(5)9)13(11)8(14)12-10/h2-4H,10-11H2,1H3,(H,12,14) |
| InChIKey | VWNGNLOAGYCJMW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|