C15H17FN4O3 — CID 139453841
1,3-diamino-1-[2-[(2-fluoro-4-hydroxy-6-methylphenoxy)methyl]phenyl]urea (PubChem CID 139453841) has the molecular formula C15H17FN4O3 and a molecular weight of 320.32 g/mol. Its IUPAC name is 1,3-diamino-1-[2-[(2-fluoro-4-hydroxy-6-methylphenoxy)methyl]phenyl]urea.
| Compound Name | 1,3-diamino-1-[2-[(2-fluoro-4-hydroxy-6-methylphenoxy)methyl]phenyl]urea |
|---|---|
| PubChem CID | 139453841 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1,3-diamino-1-[2-[(2-fluoro-4-hydroxy-6-methylphenoxy)methyl]phenyl]urea |
| SMILES | Cc1cc(O)cc(F)c1OCc1ccccc1N(N)C(=O)NN |
| InChI | InChI=1S/C15H17FN4O3/c1-9-6-11(21)7-12(16)14(9)23-8-10-4-2-3-5-13(10)20(18)15(22)19-17/h2-7,21H,8,17-18H2,1H3,(H,19,22) |
| InChIKey | SHKMIYIOZDSYSK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|