C31H34O4 — CID 155219844
[4-[4-[4-[2-methyl-3-(2-methylprop-2-enoyloxy)butan-2-yl]cyclohexa-1,3-dien-1-yl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 155219844) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is [4-[4-[4-[2-methyl-3-(2-methylprop-2-enoyloxy)butan-2-yl]cyclohexa-1,3-dien-1-yl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-[2-methyl-3-(2-methylprop-2-enoyloxy)butan-2-yl]cyclohexa-1,3-dien-1-yl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155219844 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [4-[4-[4-[2-methyl-3-(2-methylprop-2-enoyloxy)butan-2-yl]cyclohexa-1,3-dien-1-yl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(C3=CC=C(C(C)(C)C(C)OC(=O)C(=C)C)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H34O4/c1-20(2)29(32)34-22(5)31(6,7)27-16-12-25(13-17-27)23-8-10-24(11-9-23)26-14-18-28(19-15-26)35-30(33)21(3)4/h8-12,14-16,18-19,22H,1,3,13,17H2,2,4-7H3 |
| InChIKey | YGNRLBGKHMOCFS-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|