C23H28BrFN4O2 — CID 155237932
N-(5-bromo-7-fluorocyclohepta-1,4,6-trien-1-yl)-7-[4-[ethyl(methyl)amino]butoxy]-6-methoxyquinazolin-4-amine (PubChem CID 155237932) has the molecular formula C23H28BrFN4O2 and a molecular weight of 491.41 g/mol. Its IUPAC name is N-(5-bromo-7-fluorocyclohepta-1,4,6-trien-1-yl)-7-[4-[ethyl(methyl)amino]butoxy]-6-methoxyquinazolin-4-amine.
| Compound Name | N-(5-bromo-7-fluorocyclohepta-1,4,6-trien-1-yl)-7-[4-[ethyl(methyl)amino]butoxy]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 155237932 |
| Molecular Formula | C23H28BrFN4O2 |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | N-(5-bromo-7-fluorocyclohepta-1,4,6-trien-1-yl)-7-[4-[ethyl(methyl)amino]butoxy]-6-methoxyquinazolin-4-amine |
| SMILES | CCN(C)CCCCOc1cc2ncnc(NC3=CCC=C(Br)C=C3F)c2cc1OC |
| InChI | InChI=1S/C23H28BrFN4O2/c1-4-29(2)10-5-6-11-31-22-14-20-17(13-21(22)30-3)23(27-15-26-20)28-19-9-7-8-16(24)12-18(19)25/h8-9,12-15H,4-7,10-11H2,1-3H3,(H,26,27,28) |
| InChIKey | XJGMMOKYUPCXFX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|