C21H26FI2N4O2- — CID 163674533
7-[4-(dimethylamino)butoxy]-N-(4-fluoro-3-iodoiodanuidylcyclohexa-1,5-dien-1-yl)-6-methoxyquinazolin-4-amine (PubChem CID 163674533) has the molecular formula C21H26FI2N4O2- and a molecular weight of 639.27 g/mol. Its IUPAC name is 7-[4-(dimethylamino)butoxy]-N-(4-fluoro-3-iodoiodanuidylcyclohexa-1,5-dien-1-yl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[4-(dimethylamino)butoxy]-N-(4-fluoro-3-iodoiodanuidylcyclohexa-1,5-dien-1-yl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 163674533 |
| Molecular Formula | C21H26FI2N4O2- |
| Molecular Weight | 639.27 g/mol |
| Exact Mass | 639.01 |
| IUPAC Name | 7-[4-(dimethylamino)butoxy]-N-(4-fluoro-3-iodoiodanuidylcyclohexa-1,5-dien-1-yl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NC3=CC([I-]I)C(F)C=C3)ncnc2cc1OCCCCN(C)C |
| InChI | InChI=1S/C21H26FI2N4O2/c1-28(2)8-4-5-9-30-20-12-18-15(11-19(20)29-3)21(26-13-25-18)27-14-6-7-16(22)17(10-14)24-23/h6-7,10-13,16-17H,4-5,8-9H2,1-3H3,(H,25,26,27)/q-1 |
| InChIKey | WTIYUNORPDLPHJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|