C32H34N4O4 — CID 155238448
[4-[3-[2-[acetyl(methyl)amino]ethyl-ethylamino]-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] benzoate (PubChem CID 155238448) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is [4-[3-[2-[acetyl(methyl)amino]ethyl-ethylamino]-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] benzoate.
| Compound Name | [4-[3-[2-[acetyl(methyl)amino]ethyl-ethylamino]-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 155238448 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [4-[3-[2-[acetyl(methyl)amino]ethyl-ethylamino]-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] benzoate |
| SMILES | CCN(CCN(C)C(C)=O)CC(C(=O)Nc1ccc2cnccc2c1)c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N4O4/c1-4-36(19-18-35(3)23(2)37)22-30(31(38)34-28-13-10-27-21-33-17-16-26(27)20-28)24-11-14-29(15-12-24)40-32(39)25-8-6-5-7-9-25/h5-17,20-21,30H,4,18-19,22H2,1-3H3,(H,34,38) |
| InChIKey | AVDCFFWKOMHXOP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|