C22H40O3Si — CID 15525443
3-ethoxy-2,2-dimethyl-1-phenyl-3-tri(propan-2-yl)silyloxypropan-1-ol (PubChem CID 15525443) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is 3-ethoxy-2,2-dimethyl-1-phenyl-3-tri(propan-2-yl)silyloxypropan-1-ol.
| Compound Name | 3-ethoxy-2,2-dimethyl-1-phenyl-3-tri(propan-2-yl)silyloxypropan-1-ol |
|---|---|
| PubChem CID | 15525443 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 3-ethoxy-2,2-dimethyl-1-phenyl-3-tri(propan-2-yl)silyloxypropan-1-ol |
| SMILES | CCOC(O[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)C(O)c1ccccc1 |
| InChI | InChI=1S/C22H40O3Si/c1-10-24-21(25-26(16(2)3,17(4)5)18(6)7)22(8,9)20(23)19-14-12-11-13-15-19/h11-18,20-21,23H,10H2,1-9H3 |
| InChIKey | WPPFCAOOQIMZJO-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|