C15H23ClO4 — CID 155255773
2-(chloromethyl)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butanoic acid (PubChem CID 155255773) has the molecular formula C15H23ClO4 and a molecular weight of 302.80 g/mol. Its IUPAC name is 2-(chloromethyl)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butanoic acid.
| Compound Name | 2-(chloromethyl)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 155255773 |
| Molecular Formula | C15H23ClO4 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(chloromethyl)-4-oxo-4-[[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]butanoic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](OC(=O)CC(CCl)C(=O)O)C2 |
| InChI | InChI=1S/C15H23ClO4/c1-14(2)10-4-5-15(14,3)11(7-10)20-12(17)6-9(8-16)13(18)19/h9-11H,4-8H2,1-3H3,(H,18,19)/t9?,10-,11-,15+/m0/s1 |
| InChIKey | WUVOPLAHVFLBOT-KOSZXTIKSA-N |
| XLogP | 3.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|