C11H19N — CID 155267523
6-ethyl-2,3,5-trimethyl-2,7-dihydro-1H-azepine (PubChem CID 155267523) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 6-ethyl-2,3,5-trimethyl-2,7-dihydro-1H-azepine.
| Compound Name | 6-ethyl-2,3,5-trimethyl-2,7-dihydro-1H-azepine |
|---|---|
| PubChem CID | 155267523 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 6-ethyl-2,3,5-trimethyl-2,7-dihydro-1H-azepine |
| SMILES | CCC1=C(C)C=C(C)C(C)NC1 |
| InChI | InChI=1S/C11H19N/c1-5-11-7-12-10(4)8(2)6-9(11)3/h6,10,12H,5,7H2,1-4H3 |
| InChIKey | FBGGOBNHBFXYTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |