C21H27N3O7S — CID 155269264
tert-butyl 4-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]butylcarbamoyl carbonate (PubChem CID 155269264) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is tert-butyl 4-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]butylcarbamoyl carbonate.
| Compound Name | tert-butyl 4-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]butylcarbamoyl carbonate |
|---|---|
| PubChem CID | 155269264 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | tert-butyl 4-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]butylcarbamoyl carbonate |
| SMILES | CCSC(=O)N(CCCCNC(=O)OC(=O)OC(C)(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H27N3O7S/c1-5-32-19(28)23(24-16(25)14-10-6-7-11-15(14)17(24)26)13-9-8-12-22-18(27)30-20(29)31-21(2,3)4/h6-7,10-11H,5,8-9,12-13H2,1-4H3,(H,22,27) |
| InChIKey | CSQHJEQAQIYZSM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|