C28H33N3O7S — CID 155272432
tert-butyl 2-benzyl-5-carbamoyloxy-2-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]pentanoate (PubChem CID 155272432) has the molecular formula C28H33N3O7S and a molecular weight of 555.65 g/mol. Its IUPAC name is tert-butyl 2-benzyl-5-carbamoyloxy-2-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]pentanoate.
| Compound Name | tert-butyl 2-benzyl-5-carbamoyloxy-2-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]pentanoate |
|---|---|
| PubChem CID | 155272432 |
| Molecular Formula | C28H33N3O7S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | tert-butyl 2-benzyl-5-carbamoyloxy-2-[(1,3-dioxoisoindol-2-yl)-ethylsulfanylcarbonylamino]pentanoate |
| SMILES | CCSC(=O)N(N1C(=O)c2ccccc2C1=O)C(CCCOC(N)=O)(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H33N3O7S/c1-5-39-26(36)31(30-22(32)20-14-9-10-15-21(20)23(30)33)28(16-11-17-37-25(29)35,24(34)38-27(2,3)4)18-19-12-7-6-8-13-19/h6-10,12-15H,5,11,16-18H2,1-4H3,(H2,29,35) |
| InChIKey | WXRNQWBPUNFDBM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|