C39H75NO5 — CID 155278364
[(Z)-hept-2-enyl] 8-[2-hydroxyethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate (PubChem CID 155278364) has the molecular formula C39H75NO5 and a molecular weight of 638.03 g/mol. Its IUPAC name is [(Z)-hept-2-enyl] 8-[2-hydroxyethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate.
| Compound Name | [(Z)-hept-2-enyl] 8-[2-hydroxyethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate |
|---|---|
| PubChem CID | 155278364 |
| Molecular Formula | C39H75NO5 |
| Molecular Weight | 638.03 g/mol |
| Exact Mass | 637.56 |
| IUPAC Name | [(Z)-hept-2-enyl] 8-[2-hydroxyethyl-(8-oxo-8-tetradecan-7-yloxyoctyl)amino]octanoate |
| SMILES | CCCC/C=C\COC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCC)CCCCCCC |
| InChI | InChI=1S/C39H75NO5/c1-4-7-10-15-22-29-37(28-21-12-9-6-3)45-39(43)31-24-17-14-19-26-33-40(34-35-41)32-25-18-13-16-23-30-38(42)44-36-27-20-11-8-5-2/h20,27,37,41H,4-19,21-26,28-36H2,1-3H3/b27-20- |
| InChIKey | NIYMINOQGSCVSE-OOAXWGSJSA-N |
| XLogP | 10.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.03 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|