About 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate
1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate (PubChem CID 155284038) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate |
| PubChem CID | 155284038 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.CC(O)SC(C)O |
| InChI | InChI=1S/C5H8O2.C4H10O2S/c1-4(2)5(6)7-3;1-3(5)7-4(2)6/h1H2,2-3H3;3-6H,1-2H3 |
| InChIKey | KPADQKJLNHSIIE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate?
The IUPAC name of 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate (CID 155284038) is 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate.
What is the SMILES notation for 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate?
The canonical SMILES for 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.CC(O)SC(C)O.
What is the InChIKey of 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate?
The InChIKey is KPADQKJLNHSIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H10O2S/c1-4(2)5(6)7-3;1-3(5)7-4(2)6/h1H2,2-3H3;3-6H,1-2H3.
What are the key properties of 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate?
1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate has a molecular weight of 222.31 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-hydroxyethylsulfanyl)ethanol;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 155284038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).