C13H14O4 — CID 15528853
(6aS,7S,10aR)-7-hydroxy-6a,7,8,9,10,10a-hexahydrobenzo[b][1,4]benzodioxepin-6-one (PubChem CID 15528853) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (6aS,7S,10aR)-7-hydroxy-6a,7,8,9,10,10a-hexahydrobenzo[b][1,4]benzodioxepin-6-one.
| Compound Name | (6aS,7S,10aR)-7-hydroxy-6a,7,8,9,10,10a-hexahydrobenzo[b][1,4]benzodioxepin-6-one |
|---|---|
| PubChem CID | 15528853 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (6aS,7S,10aR)-7-hydroxy-6a,7,8,9,10,10a-hexahydrobenzo[b][1,4]benzodioxepin-6-one |
| SMILES | O=C1Oc2ccccc2O[C@@H]2CCC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C13H14O4/c14-8-4-3-7-11-12(8)13(15)17-10-6-2-1-5-9(10)16-11/h1-2,5-6,8,11-12,14H,3-4,7H2/t8-,11+,12-/m0/s1 |
| InChIKey | FAEFINZBRADFDP-AXTRIDKLSA-N |
| XLogP | 1.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|