C13H17NO2 — CID 102506053
(1S,4aR,9S,9aS)-9-amino-2,3,4,4a,9,9a-hexahydro-1H-xanthen-1-ol (PubChem CID 102506053) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (1S,4aR,9S,9aS)-9-amino-2,3,4,4a,9,9a-hexahydro-1H-xanthen-1-ol.
| Compound Name | (1S,4aR,9S,9aS)-9-amino-2,3,4,4a,9,9a-hexahydro-1H-xanthen-1-ol |
|---|---|
| PubChem CID | 102506053 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (1S,4aR,9S,9aS)-9-amino-2,3,4,4a,9,9a-hexahydro-1H-xanthen-1-ol |
| SMILES | N[C@@H]1c2ccccc2O[C@@H]2CCC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C13H17NO2/c14-13-8-4-1-2-6-10(8)16-11-7-3-5-9(15)12(11)13/h1-2,4,6,9,11-13,15H,3,5,7,14H2/t9-,11+,12-,13+/m0/s1 |
| InChIKey | XCCMPRSJUUHITP-ZBAXXZLZSA-N |
| XLogP | 1.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |