C17H16O2S2 — CID 138964650
(8R,20R)-13-oxa-3,5-dithiapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one (PubChem CID 138964650) has the molecular formula C17H16O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (8R,20R)-13-oxa-3,5-dithiapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one.
| Compound Name | (8R,20R)-13-oxa-3,5-dithiapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one |
|---|---|
| PubChem CID | 138964650 |
| Molecular Formula | C17H16O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (8R,20R)-13-oxa-3,5-dithiapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),14,16,18-tetraen-4-one |
| SMILES | O=c1sc2c(s1)C1c3ccccc3OC3CCC[C@H](C2)[C@@H]31 |
| InChI | InChI=1S/C17H16O2S2/c18-17-20-13-8-9-4-3-7-12-14(9)15(16(13)21-17)10-5-1-2-6-11(10)19-12/h1-2,5-6,9,12,14-15H,3-4,7-8H2/t9-,12?,14+,15?/m1/s1 |
| InChIKey | GIENKOHLAVDJFD-UXLHTXSSSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |