C15H17IO — CID 15430427
(1R,7S)-7-iodo-1-phenyl-1,3,3a,4,5,6,7,7a-octahydroinden-2-one (PubChem CID 15430427) has the molecular formula C15H17IO and a molecular weight of 340.20 g/mol. Its IUPAC name is (1R,7S)-7-iodo-1-phenyl-1,3,3a,4,5,6,7,7a-octahydroinden-2-one.
| Compound Name | (1R,7S)-7-iodo-1-phenyl-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
|---|---|
| PubChem CID | 15430427 |
| Molecular Formula | C15H17IO |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (1R,7S)-7-iodo-1-phenyl-1,3,3a,4,5,6,7,7a-octahydroinden-2-one |
| SMILES | O=C1CC2CCCC(I)C2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H17IO/c16-12-8-4-7-11-9-13(17)15(14(11)12)10-5-2-1-3-6-10/h1-3,5-6,11-12,14-15H,4,7-9H2/t11?,12?,14?,15-/m1/s1 |
| InChIKey | NUYVSHXXFBVNRQ-HKTMVNTCSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|