C12H11Cl2F3N4 — CID 155294550
8-(4-chlorophenyl)-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 155294550) has the molecular formula C12H11Cl2F3N4 and a molecular weight of 339.15 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 8-(4-chlorophenyl)-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 155294550 |
| Molecular Formula | C12H11Cl2F3N4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 8-(4-chlorophenyl)-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1nnc2n1CCNC2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClF3N4.ClH/c13-8-3-1-7(2-4-8)9-10-18-19-11(12(14,15)16)20(10)6-5-17-9;/h1-4,9,17H,5-6H2;1H |
| InChIKey | CXBFHYPMBQYMKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |