C21H20O4Se — CID 15529625
dimethyl 6-methyl-1-(4-methylphenyl)-1H-isoselenochromene-3,4-dicarboxylate (PubChem CID 15529625) has the molecular formula C21H20O4Se and a molecular weight of 415.35 g/mol. Its IUPAC name is dimethyl 6-methyl-1-(4-methylphenyl)-1H-isoselenochromene-3,4-dicarboxylate.
| Compound Name | dimethyl 6-methyl-1-(4-methylphenyl)-1H-isoselenochromene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15529625 |
| Molecular Formula | C21H20O4Se |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | dimethyl 6-methyl-1-(4-methylphenyl)-1H-isoselenochromene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)c2cc(C)ccc2C(c2ccc(C)cc2)[Se]1 |
| InChI | InChI=1S/C21H20O4Se/c1-12-5-8-14(9-6-12)18-15-10-7-13(2)11-16(15)17(20(22)24-3)19(26-18)21(23)25-4/h5-11,18H,1-4H3 |
| InChIKey | RNKPXEXDMHEZJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|