C19H32O2 — CID 155299279
4,5-ditert-butyl-2-[(E)-2-methylhex-4-en-2-yl]furan-3-one (PubChem CID 155299279) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-[(E)-2-methylhex-4-en-2-yl]furan-3-one.
| Compound Name | 4,5-ditert-butyl-2-[(E)-2-methylhex-4-en-2-yl]furan-3-one |
|---|---|
| PubChem CID | 155299279 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4,5-ditert-butyl-2-[(E)-2-methylhex-4-en-2-yl]furan-3-one |
| SMILES | C/C=C/CC(C)(C)C1OC(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C19H32O2/c1-10-11-12-19(8,9)16-14(20)13(17(2,3)4)15(21-16)18(5,6)7/h10-11,16H,12H2,1-9H3/b11-10+ |
| InChIKey | ZSNCVDKGGFVTIA-ZHACJKMWSA-N |
| XLogP | 5.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|