C15H17FN2O — CID 155310830
2-[(3Z,5E)-5-fluorohepta-3,5-dienyl]-N-methyl-1,3-benzoxazol-5-amine (PubChem CID 155310830) has the molecular formula C15H17FN2O and a molecular weight of 260.31 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-fluorohepta-3,5-dienyl]-N-methyl-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(3Z,5E)-5-fluorohepta-3,5-dienyl]-N-methyl-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 155310830 |
| Molecular Formula | C15H17FN2O |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-[(3Z,5E)-5-fluorohepta-3,5-dienyl]-N-methyl-1,3-benzoxazol-5-amine |
| SMILES | C/C=C(F)\C=C/CCc1nc2cc(NC)ccc2o1 |
| InChI | InChI=1S/C15H17FN2O/c1-3-11(16)6-4-5-7-15-18-13-10-12(17-2)8-9-14(13)19-15/h3-4,6,8-10,17H,5,7H2,1-2H3/b6-4-,11-3+ |
| InChIKey | WTVRGZXEMRBOTK-TYTBFOFYSA-N |
| XLogP | 4.23 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|