C10H9ClF3N4O2P — CID 155313477
4-chloro-N-methylphosphanyl-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-amine (PubChem CID 155313477) has the molecular formula C10H9ClF3N4O2P and a molecular weight of 340.63 g/mol. Its IUPAC name is 4-chloro-N-methylphosphanyl-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-amine.
| Compound Name | 4-chloro-N-methylphosphanyl-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-amine |
|---|---|
| PubChem CID | 155313477 |
| Molecular Formula | C10H9ClF3N4O2P |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-chloro-N-methylphosphanyl-7-nitro-1-(2,2,2-trifluoroethyl)indazol-3-amine |
| SMILES | CPNc1nn(CC(F)(F)F)c2c([N+](=O)[O-])ccc(Cl)c12 |
| InChI | InChI=1S/C10H9ClF3N4O2P/c1-21-16-9-7-5(11)2-3-6(18(19)20)8(7)17(15-9)4-10(12,13)14/h2-3,21H,4H2,1H3,(H,15,16) |
| InChIKey | QQDHYQJWCSSEDM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|