C13H17Br2N3O2 — CID 155319518
N'-[2,6-bis(bromomethyl)-4-pyridinyl]hexanediamide (PubChem CID 155319518) has the molecular formula C13H17Br2N3O2 and a molecular weight of 407.11 g/mol. Its IUPAC name is N'-[2,6-bis(bromomethyl)-4-pyridinyl]hexanediamide.
| Compound Name | N'-[2,6-bis(bromomethyl)-4-pyridinyl]hexanediamide |
|---|---|
| PubChem CID | 155319518 |
| Molecular Formula | C13H17Br2N3O2 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.97 |
| IUPAC Name | N'-[2,6-bis(bromomethyl)-4-pyridinyl]hexanediamide |
| SMILES | NC(=O)CCCCC(=O)Nc1cc(CBr)nc(CBr)c1 |
| InChI | InChI=1S/C13H17Br2N3O2/c14-7-10-5-9(6-11(8-15)17-10)18-13(20)4-2-1-3-12(16)19/h5-6H,1-4,7-8H2,(H2,16,19)(H,17,18,20) |
| InChIKey | HASSRKRETKHVFP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|