C13H19N5O5 — CID 155321355
(2S)-2-amino-5-(carbamoylamino)-N-[4-(hydroxymethyl)-3-nitrophenyl]pentanamide (PubChem CID 155321355) has the molecular formula C13H19N5O5 and a molecular weight of 325.33 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)-N-[4-(hydroxymethyl)-3-nitrophenyl]pentanamide.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)-N-[4-(hydroxymethyl)-3-nitrophenyl]pentanamide |
|---|---|
| PubChem CID | 155321355 |
| Molecular Formula | C13H19N5O5 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)-N-[4-(hydroxymethyl)-3-nitrophenyl]pentanamide |
| SMILES | NC(=O)NCCC[C@H](N)C(=O)Nc1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N5O5/c14-10(2-1-5-16-13(15)21)12(20)17-9-4-3-8(7-19)11(6-9)18(22)23/h3-4,6,10,19H,1-2,5,7,14H2,(H,17,20)(H3,15,16,21)/t10-/m0/s1 |
| InChIKey | QNHRMYGWZIAVEH-JTQLQIEISA-N |
| XLogP | -0.20 |
| TPSA | 173.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|