C17H23NO5 — CID 15532193
dimethyl (5S,6R,7R)-4-ethyl-7-phenyl-1,4-oxazepane-5,6-dicarboxylate (PubChem CID 15532193) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is dimethyl (5S,6R,7R)-4-ethyl-7-phenyl-1,4-oxazepane-5,6-dicarboxylate.
| Compound Name | dimethyl (5S,6R,7R)-4-ethyl-7-phenyl-1,4-oxazepane-5,6-dicarboxylate |
|---|---|
| PubChem CID | 15532193 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | dimethyl (5S,6R,7R)-4-ethyl-7-phenyl-1,4-oxazepane-5,6-dicarboxylate |
| SMILES | CCN1CCO[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H23NO5/c1-4-18-10-11-23-15(12-8-6-5-7-9-12)13(16(19)21-2)14(18)17(20)22-3/h5-9,13-15H,4,10-11H2,1-3H3/t13-,14+,15+/m1/s1 |
| InChIKey | IHHSBNKEVFJUFT-ILXRZTDVSA-N |
| XLogP | 1.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |