C26H29F2N5O5 — CID 155327372
N-[[3-[4-[3-(dimethylcarbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-formyl-N-methylbenzamide (PubChem CID 155327372) has the molecular formula C26H29F2N5O5 and a molecular weight of 529.54 g/mol. Its IUPAC name is N-[[3-[4-[3-(dimethylcarbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-formyl-N-methylbenzamide.
| Compound Name | N-[[3-[4-[3-(dimethylcarbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-formyl-N-methylbenzamide |
|---|---|
| PubChem CID | 155327372 |
| Molecular Formula | C26H29F2N5O5 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | N-[[3-[4-[3-(dimethylcarbamoylamino)pyrrolidin-1-yl]-3,5-difluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-2-formyl-N-methylbenzamide |
| SMILES | CN(C)C(=O)NC1CCN(c2c(F)cc(N3CC(CN(C)C(=O)c4ccccc4C=O)OC3=O)cc2F)C1 |
| InChI | InChI=1S/C26H29F2N5O5/c1-30(2)25(36)29-17-8-9-32(12-17)23-21(27)10-18(11-22(23)28)33-14-19(38-26(33)37)13-31(3)24(35)20-7-5-4-6-16(20)15-34/h4-7,10-11,15,17,19H,8-9,12-14H2,1-3H3,(H,29,36) |
| InChIKey | JTXWXYYPJFOAQQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|