C18H17NO4S — CID 155327439
(3S)-3-benzyl-3-(phenylmethoxycarbonylamino)thiirane-2-carboxylic acid (PubChem CID 155327439) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is (3S)-3-benzyl-3-(phenylmethoxycarbonylamino)thiirane-2-carboxylic acid.
| Compound Name | (3S)-3-benzyl-3-(phenylmethoxycarbonylamino)thiirane-2-carboxylic acid |
|---|---|
| PubChem CID | 155327439 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (3S)-3-benzyl-3-(phenylmethoxycarbonylamino)thiirane-2-carboxylic acid |
| SMILES | O=C(N[C@@]1(Cc2ccccc2)SC1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H17NO4S/c20-16(21)15-18(24-15,11-13-7-3-1-4-8-13)19-17(22)23-12-14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,19,22)(H,20,21)/t15?,18-/m0/s1 |
| InChIKey | DKSBMKZJPZFIQX-PKHIMPSTSA-N |
| XLogP | 3.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|