C9H21N3 — CID 155329282
(E)-2-ethyl-1-N,1-N',1-N'-trimethylbut-2-ene-1,1,4-triamine (PubChem CID 155329282) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is (E)-2-ethyl-1-N,1-N',1-N'-trimethylbut-2-ene-1,1,4-triamine.
| Compound Name | (E)-2-ethyl-1-N,1-N',1-N'-trimethylbut-2-ene-1,1,4-triamine |
|---|---|
| PubChem CID | 155329282 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | (E)-2-ethyl-1-N,1-N',1-N'-trimethylbut-2-ene-1,1,4-triamine |
| SMILES | CC/C(=C\CN)C(NC)N(C)C |
| InChI | InChI=1S/C9H21N3/c1-5-8(6-7-10)9(11-2)12(3)4/h6,9,11H,5,7,10H2,1-4H3/b8-6+ |
| InChIKey | LXWGNHXUWNSAEN-SOFGYWHQSA-N |
| XLogP | 0.39 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|