C15H21N7O6S — CID 155337637
[(2S,5R)-2-[5-[1-[(diaminomethylideneamino)methyl]cyclopropyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate (PubChem CID 155337637) has the molecular formula C15H21N7O6S and a molecular weight of 427.44 g/mol. Its IUPAC name is [(2S,5R)-2-[5-[1-[(diaminomethylideneamino)methyl]cyclopropyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[5-[1-[(diaminomethylideneamino)methyl]cyclopropyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 155337637 |
| Molecular Formula | C15H21N7O6S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [(2S,5R)-2-[5-[1-[(diaminomethylideneamino)methyl]cyclopropyl]-1,3,4-oxadiazol-2-yl]-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
| SMILES | NC(N)=NCC1(c2nnc([C@@H]3CC4(CC4)[C@@H]4CN3C(=O)N4OS(=O)(=O)O)o2)CC1 |
| InChI | InChI=1S/C15H21N7O6S/c16-12(17)18-7-15(3-4-15)11-20-19-10(27-11)8-5-14(1-2-14)9-6-21(8)13(23)22(9)28-29(24,25)26/h8-9H,1-7H2,(H4,16,17,18)(H,24,25,26)/t8-,9-/m0/s1 |
| InChIKey | SNWHVRQCEOZZPK-IUCAKERBSA-N |
| XLogP | -0.56 |
| TPSA | 190.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|