C11H18N4O7S — CID 123192557
[2-(2-aminoethoxycarbamoyl)-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate (PubChem CID 123192557) has the molecular formula C11H18N4O7S and a molecular weight of 350.35 g/mol. Its IUPAC name is [2-(2-aminoethoxycarbamoyl)-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate.
| Compound Name | [2-(2-aminoethoxycarbamoyl)-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123192557 |
| Molecular Formula | C11H18N4O7S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [2-(2-aminoethoxycarbamoyl)-7-oxospiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
| SMILES | NCCONC(=O)C1CC2(CC2)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C11H18N4O7S/c12-3-4-21-13-9(16)7-5-11(1-2-11)8-6-14(7)10(17)15(8)22-23(18,19)20/h7-8H,1-6,12H2,(H,13,16)(H,18,19,20) |
| InChIKey | VJKBJCUSLOQYOC-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|