C14H22N4O7S — CID 123493107
[7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate (PubChem CID 123493107) has the molecular formula C14H22N4O7S and a molecular weight of 390.42 g/mol. Its IUPAC name is [7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123493107 |
| Molecular Formula | C14H22N4O7S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [7-oxo-2-(piperidin-3-yloxycarbamoyl)spiro[1,6-diazabicyclo[3.2.1]octane-4,1'-cyclopropane]-6-yl] hydrogen sulfate |
| SMILES | O=C(NOC1CCCNC1)C1CC2(CC2)C2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H22N4O7S/c19-12(16-24-9-2-1-5-15-7-9)10-6-14(3-4-14)11-8-17(10)13(20)18(11)25-26(21,22)23/h9-11,15H,1-8H2,(H,16,19)(H,21,22,23) |
| InChIKey | GBGDXSFXXMKYDV-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|